C7H5ClF2 — CID 58691509
1-chloro-2,4-difluoro-5-methylbenzene (PubChem CID 58691509) has the molecular formula C7H5ClF2 and a molecular weight of 162.57 g/mol. Its IUPAC name is 1-chloro-2,4-difluoro-5-methylbenzene.
| Compound Name | 1-chloro-2,4-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 58691509 |
| Molecular Formula | C7H5ClF2 |
| Molecular Weight | 162.57 g/mol |
| Exact Mass | 162.00 |
| IUPAC Name | 1-chloro-2,4-difluoro-5-methylbenzene |
| SMILES | Cc1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C7H5ClF2/c1-4-2-5(8)7(10)3-6(4)9/h2-3H,1H3 |
| InChIKey | RHLAJEKVHZLEFY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|