C40H48N8O4 — CID 58691511
2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-N-[[4-[[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroanilino]methyl]cyclohexyl]methyl]-4-nitroaniline (PubChem CID 58691511) has the molecular formula C40H48N8O4 and a molecular weight of 704.88 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-N-[[4-[[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroanilino]methyl]cyclohexyl]methyl]-4-nitroaniline.
| Compound Name | 2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-N-[[4-[[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroanilino]methyl]cyclohexyl]methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 58691511 |
| Molecular Formula | C40H48N8O4 |
| Molecular Weight | 704.88 g/mol |
| Exact Mass | 704.38 |
| IUPAC Name | 2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-N-[[4-[[2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitroanilino]methyl]cyclohexyl]methyl]-4-nitroaniline |
| SMILES | Cn1cc(C#CC(C)(C)C)c(-c2cc([N+](=O)[O-])ccc2NCC2CCC(CNc3ccc([N+](=O)[O-])cc3-c3nn(C)cc3C#CC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C40H48N8O4/c1-39(2,3)19-17-29-25-45(7)43-37(29)33-21-31(47(49)50)13-15-35(33)41-23-27-9-11-28(12-10-27)24-42-36-16-14-32(48(51)52)22-34(36)38-30(26-46(8)44-38)18-20-40(4,5)6/h13-16,21-22,25-28,41-42H,9-12,23-24H2,1-8H3 |
| InChIKey | DNWRXKRODQKNQE-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 145.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.88 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|