C23H20F4N4O2 — CID 58691582
2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitro-N-[(2,3,5,6-tetrafluorophenyl)methyl]aniline (PubChem CID 58691582) has the molecular formula C23H20F4N4O2 and a molecular weight of 460.43 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitro-N-[(2,3,5,6-tetrafluorophenyl)methyl]aniline.
| Compound Name | 2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitro-N-[(2,3,5,6-tetrafluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 58691582 |
| Molecular Formula | C23H20F4N4O2 |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 2-[4-(3,3-dimethylbut-1-ynyl)-1-methylpyrazol-3-yl]-4-nitro-N-[(2,3,5,6-tetrafluorophenyl)methyl]aniline |
| SMILES | Cn1cc(C#CC(C)(C)C)c(-c2cc([N+](=O)[O-])ccc2NCc2c(F)c(F)cc(F)c2F)n1 |
| InChI | InChI=1S/C23H20F4N4O2/c1-23(2,3)8-7-13-12-30(4)29-22(13)15-9-14(31(32)33)5-6-19(15)28-11-16-20(26)17(24)10-18(25)21(16)27/h5-6,9-10,12,28H,11H2,1-4H3 |
| InChIKey | MOPAIGROCZNTTE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|