C10H20FNO3S — CID 58691855
(2R)-3-(cyclohexylmethylamino)-2-fluoropropane-1-sulfonic acid (PubChem CID 58691855) has the molecular formula C10H20FNO3S and a molecular weight of 253.34 g/mol. Its IUPAC name is (2R)-3-(cyclohexylmethylamino)-2-fluoropropane-1-sulfonic acid.
| Compound Name | (2R)-3-(cyclohexylmethylamino)-2-fluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58691855 |
| Molecular Formula | C10H20FNO3S |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2R)-3-(cyclohexylmethylamino)-2-fluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C[C@H](F)CNCC1CCCCC1 |
| InChI | InChI=1S/C10H20FNO3S/c11-10(8-16(13,14)15)7-12-6-9-4-2-1-3-5-9/h9-10,12H,1-8H2,(H,13,14,15)/t10-/m1/s1 |
| InChIKey | RRAHVCBEDMJYRI-SNVBAGLBSA-N |
| XLogP | 1.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|