C15H25F2NO3S — CID 58691906
3-[(3,5-dimethyl-1-adamantyl)amino]-2,2-difluoropropane-1-sulfonic acid (PubChem CID 58691906) has the molecular formula C15H25F2NO3S and a molecular weight of 337.43 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1-adamantyl)amino]-2,2-difluoropropane-1-sulfonic acid.
| Compound Name | 3-[(3,5-dimethyl-1-adamantyl)amino]-2,2-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58691906 |
| Molecular Formula | C15H25F2NO3S |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 3-[(3,5-dimethyl-1-adamantyl)amino]-2,2-difluoropropane-1-sulfonic acid |
| SMILES | CC12CC3CC(C)(C1)CC(NCC(F)(F)CS(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C15H25F2NO3S/c1-12-3-11-4-13(2,6-12)8-14(5-11,7-12)18-9-15(16,17)10-22(19,20)21/h11,18H,3-10H2,1-2H3,(H,19,20,21) |
| InChIKey | ZYEJQOOAOUNGHC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|