C11H16FNO3S — CID 58691927
3-[2-(2-fluorophenyl)ethylamino]propane-1-sulfonic acid (PubChem CID 58691927) has the molecular formula C11H16FNO3S and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)ethylamino]propane-1-sulfonic acid.
| Compound Name | 3-[2-(2-fluorophenyl)ethylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58691927 |
| Molecular Formula | C11H16FNO3S |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 3-[2-(2-fluorophenyl)ethylamino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNCCc1ccccc1F |
| InChI | InChI=1S/C11H16FNO3S/c12-11-5-2-1-4-10(11)6-8-13-7-3-9-17(14,15)16/h1-2,4-5,13H,3,6-9H2,(H,14,15,16) |
| InChIKey | SIWPUWNRAQWSSD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|