C25H33N7O9 — CID 58692085
3-(2,6-diacetamidohexanoylamino)-N,N'-bis[(2,5-dioxopyrrol-1-yl)methyl]pentanediamide (PubChem CID 58692085) has the molecular formula C25H33N7O9 and a molecular weight of 575.58 g/mol. Its IUPAC name is 3-(2,6-diacetamidohexanoylamino)-N,N'-bis[(2,5-dioxopyrrol-1-yl)methyl]pentanediamide.
| Compound Name | 3-(2,6-diacetamidohexanoylamino)-N,N'-bis[(2,5-dioxopyrrol-1-yl)methyl]pentanediamide |
|---|---|
| PubChem CID | 58692085 |
| Molecular Formula | C25H33N7O9 |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 3-(2,6-diacetamidohexanoylamino)-N,N'-bis[(2,5-dioxopyrrol-1-yl)methyl]pentanediamide |
| SMILES | CC(=O)NCCCCC(NC(C)=O)C(=O)NC(CC(=O)NCN1C(=O)C=CC1=O)CC(=O)NCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C25H33N7O9/c1-15(33)26-10-4-3-5-18(29-16(2)34)25(41)30-17(11-19(35)27-13-31-21(37)6-7-22(31)38)12-20(36)28-14-32-23(39)8-9-24(32)40/h6-9,17-18H,3-5,10-14H2,1-2H3,(H,26,33)(H,27,35)(H,28,36)(H,29,34)(H,30,41) |
| InChIKey | YREFHXFMHVNMKE-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 220.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|