C24H42Br2Si — CID 58692107
bis(4-bromo-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-diethylsilane (PubChem CID 58692107) has the molecular formula C24H42Br2Si and a molecular weight of 518.49 g/mol. Its IUPAC name is bis(4-bromo-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-diethylsilane.
| Compound Name | bis(4-bromo-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-diethylsilane |
|---|---|
| PubChem CID | 58692107 |
| Molecular Formula | C24H42Br2Si |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | bis(4-bromo-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-diethylsilane |
| SMILES | CC[Si](CC)(C1C(C)CC2C(Br)CCCC21)C1C(C)CC2C(Br)CCCC21 |
| InChI | InChI=1S/C24H42Br2Si/c1-5-27(6-2,23-15(3)13-19-17(23)9-7-11-21(19)25)24-16(4)14-20-18(24)10-8-12-22(20)26/h15-24H,5-14H2,1-4H3 |
| InChIKey | UFVFLASWFLTQPR-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|