C11H19Br — CID 58692113
2-bromo-4,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 58692113) has the molecular formula C11H19Br and a molecular weight of 231.18 g/mol. Its IUPAC name is 2-bromo-4,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 2-bromo-4,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 58692113 |
| Molecular Formula | C11H19Br |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-bromo-4,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CC1CCC(C)C2CC(Br)CC12 |
| InChI | InChI=1S/C11H19Br/c1-7-3-4-8(2)11-6-9(12)5-10(7)11/h7-11H,3-6H2,1-2H3 |
| InChIKey | SRYSKLOSGTYFKN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|