C26H46Br2Si — CID 58692118
bis(4-bromo-2-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane (PubChem CID 58692118) has the molecular formula C26H46Br2Si and a molecular weight of 546.55 g/mol. Its IUPAC name is bis(4-bromo-2-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane.
| Compound Name | bis(4-bromo-2-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 58692118 |
| Molecular Formula | C26H46Br2Si |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | bis(4-bromo-2-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane |
| SMILES | CC(C)C1CC2C(Br)CCCC2C1[Si](C)(C)C1C(C(C)C)CC2C(Br)CCCC21 |
| InChI | InChI=1S/C26H46Br2Si/c1-15(2)19-13-21-17(9-7-11-23(21)27)25(19)29(5,6)26-18-10-8-12-24(28)22(18)14-20(26)16(3)4/h15-26H,7-14H2,1-6H3 |
| InChIKey | OTHFHOIZULRIOX-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|