C20H18ClN5O3S — CID 58692213
2-[3-chloro-4-[[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-yl]amino]phenyl]ethyl methanesulfonate (PubChem CID 58692213) has the molecular formula C20H18ClN5O3S and a molecular weight of 443.92 g/mol. Its IUPAC name is 2-[3-chloro-4-[[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-yl]amino]phenyl]ethyl methanesulfonate.
| Compound Name | 2-[3-chloro-4-[[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-yl]amino]phenyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 58692213 |
| Molecular Formula | C20H18ClN5O3S |
| Molecular Weight | 443.92 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 2-[3-chloro-4-[[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-yl]amino]phenyl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCc1ccc(Nc2nccc(-c3c[nH]c4ncccc34)n2)c(Cl)c1 |
| InChI | InChI=1S/C20H18ClN5O3S/c1-30(27,28)29-10-7-13-4-5-18(16(21)11-13)26-20-23-9-6-17(25-20)15-12-24-19-14(15)3-2-8-22-19/h2-6,8-9,11-12H,7,10H2,1H3,(H,22,24)(H,23,25,26) |
| InChIKey | BOIJKUOINKSWPB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.92 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|