C36H46N4Pd — CID 58692871
(4Z,9Z,14Z,19Z)-2,3,7,8,12,13,17,18-octaethyl-1,11-dihydroporphyrin-21,23-diide;palladium(2+) (PubChem CID 58692871) has the molecular formula C36H46N4Pd and a molecular weight of 641.21 g/mol. Its IUPAC name is (4Z,9Z,14Z,19Z)-2,3,7,8,12,13,17,18-octaethyl-1,11-dihydroporphyrin-21,23-diide;palladium(2+).
| Compound Name | (4Z,9Z,14Z,19Z)-2,3,7,8,12,13,17,18-octaethyl-1,11-dihydroporphyrin-21,23-diide;palladium(2+) |
|---|---|
| PubChem CID | 58692871 |
| Molecular Formula | C36H46N4Pd |
| Molecular Weight | 641.21 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | (4Z,9Z,14Z,19Z)-2,3,7,8,12,13,17,18-octaethyl-1,11-dihydroporphyrin-21,23-diide;palladium(2+) |
| SMILES | CCC1=C(CC)/C2=C/C3[N-]/C(=C\C4=N/C(=C\C5[N-]/C(=C\C1=N2)C(CC)=C5CC)C(CC)=C4CC)C(CC)=C3CC.[Pd+2] |
| InChI | InChI=1S/C36H46N4.Pd/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20,29,36H,9-16H2,1-8H3;/q-2;+2/b30-18-,31-17-,34-20-,35-19-; |
| InChIKey | NSFJFPAOZNUZBM-CLUNTYBZSA-N |
| XLogP | 10.42 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.21 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |