C52H36N2O2 — CID 58692908
2,4,6-triphenyl-3-[4-[(2,4,6-triphenyl-3-pyridinyl)oxy]phenoxy]pyridine (PubChem CID 58692908) has the molecular formula C52H36N2O2 and a molecular weight of 720.87 g/mol. Its IUPAC name is 2,4,6-triphenyl-3-[4-[(2,4,6-triphenyl-3-pyridinyl)oxy]phenoxy]pyridine.
| Compound Name | 2,4,6-triphenyl-3-[4-[(2,4,6-triphenyl-3-pyridinyl)oxy]phenoxy]pyridine |
|---|---|
| PubChem CID | 58692908 |
| Molecular Formula | C52H36N2O2 |
| Molecular Weight | 720.87 g/mol |
| Exact Mass | 720.28 |
| IUPAC Name | 2,4,6-triphenyl-3-[4-[(2,4,6-triphenyl-3-pyridinyl)oxy]phenoxy]pyridine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c(Oc3ccc(Oc4c(-c5ccccc5)cc(-c5ccccc5)nc4-c4ccccc4)cc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C52H36N2O2/c1-7-19-37(20-8-1)45-35-47(39-23-11-3-12-24-39)53-49(41-27-15-5-16-28-41)51(45)55-43-31-33-44(34-32-43)56-52-46(38-21-9-2-10-22-38)36-48(40-25-13-4-14-26-40)54-50(52)42-29-17-6-18-30-42/h1-36H |
| InChIKey | CXOMPJTVIWGRLV-UHFFFAOYSA-N |
| XLogP | 14.06 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.87 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |