About 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine
4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine (PubChem CID 58692960) has the molecular formula C40H27BrN2
and a molecular weight of 615.57 g/mol. Its IUPAC name is 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine.
Molecular Properties
| Compound Name | 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine |
| PubChem CID | 58692960 |
| Molecular Formula | C40H27BrN2 |
| Molecular Weight | 615.57 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine |
| SMILES | Brc1cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C40H27BrN2/c41-36-22-32(34-24-37(28-13-5-1-6-14-28)42-38(25-34)29-15-7-2-8-16-29)21-33(23-36)35-26-39(30-17-9-3-10-18-30)43-40(27-35)31-19-11-4-12-20-31/h1-27H |
| InChIKey | CEJMAFZLAJVBQF-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 615.57 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine?
The IUPAC name of 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine (CID 58692960) is 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine.
What is the SMILES notation for 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine?
The canonical SMILES for 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine is Brc1cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)c1.
What is the InChIKey of 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine?
The InChIKey is CEJMAFZLAJVBQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H27BrN2/c41-36-22-32(34-24-37(28-13-5-1-6-14-28)42-38(25-34)29-15-7-2-8-16-29)21-33(23-36)35-26-39(30-17-9-3-10-18-30)43-40(27-35)31-19-11-4-12-20-31/h1-27H.
What are the key properties of 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine?
4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine has a molecular weight of 615.57 g/mol, XLogP of 11.24, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-bromo-5-(2,6-diphenyl-4-pyridinyl)phenyl]-2,6-diphenylpyridine is sourced from PubChem (CID 58692960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).