C13H15NO — CID 58692968
1-cyclohexa-1,5-dien-1-yl-2-(2H-pyridin-1-yl)ethanone (PubChem CID 58692968) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-(2H-pyridin-1-yl)ethanone.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-(2H-pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 58692968 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-(2H-pyridin-1-yl)ethanone |
| SMILES | O=C(CN1C=CC=CC1)C1=CCCC=C1 |
| InChI | InChI=1S/C13H15NO/c15-13(12-7-3-1-4-8-12)11-14-9-5-2-6-10-14/h2-3,5-9H,1,4,10-11H2 |
| InChIKey | WLGIGIMNXRELCY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |