C32H38N4Pt — CID 58693025
platinum(2+);(4Z,9Z,14Z,19Z)-2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-1,11-dihydroporphyrin-21,23-diide (PubChem CID 58693025) has the molecular formula C32H38N4Pt and a molecular weight of 673.76 g/mol. Its IUPAC name is platinum(2+);(4Z,9Z,14Z,19Z)-2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-1,11-dihydroporphyrin-21,23-diide.
| Compound Name | platinum(2+);(4Z,9Z,14Z,19Z)-2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-1,11-dihydroporphyrin-21,23-diide |
|---|---|
| PubChem CID | 58693025 |
| Molecular Formula | C32H38N4Pt |
| Molecular Weight | 673.76 g/mol |
| Exact Mass | 673.27 |
| IUPAC Name | platinum(2+);(4Z,9Z,14Z,19Z)-2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-1,11-dihydroporphyrin-21,23-diide |
| SMILES | CCC1=C(C)/C2=C/C3[N-]/C(=C\C4=N/C(=C\C5[N-]/C(=C\C1=N2)C(C)=C5CC)C(C)=C4CC)C(C)=C3CC.[Pt+2] |
| InChI | InChI=1S/C32H38N4.Pt/c1-9-21-17(5)25-14-30-23(11-3)19(7)27(35-30)16-32-24(12-4)20(8)28(36-32)15-31-22(10-2)18(6)26(34-31)13-29(21)33-25;/h13-16,29,32H,9-12H2,1-8H3;/q-2;+2/b25-14-,26-13-,27-16-,28-15-; |
| InChIKey | ZUHNIWDDLBWKRW-LJULZBQYSA-N |
| XLogP | 8.86 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.76 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |