C56H38F6O5S — CID 58693255
[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-[4-[4-methyl-3-(4-sulfanylbenzoyl)phenyl]benzoyl]phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]-(4-methylphenyl)methanone (PubChem CID 58693255) has the molecular formula C56H38F6O5S and a molecular weight of 936.97 g/mol. Its IUPAC name is [4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-[4-[4-methyl-3-(4-sulfanylbenzoyl)phenyl]benzoyl]phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]-(4-methylphenyl)methanone.
| Compound Name | [4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-[4-[4-methyl-3-(4-sulfanylbenzoyl)phenyl]benzoyl]phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 58693255 |
| Molecular Formula | C56H38F6O5S |
| Molecular Weight | 936.97 g/mol |
| Exact Mass | 936.23 |
| IUPAC Name | [4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-[4-[4-methyl-3-(4-sulfanylbenzoyl)phenyl]benzoyl]phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2ccc(Oc3ccc(C(c4ccc(Oc5ccc(C(=O)c6ccc(-c7ccc(C)c(C(=O)c8ccc(S)cc8)c7)cc6)cc5)cc4)(C(F)(F)F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C56H38F6O5S/c1-34-3-6-37(7-4-34)51(63)39-13-23-45(24-14-39)66-47-27-19-43(20-28-47)54(55(57,58)59,56(60,61)62)44-21-29-48(30-22-44)67-46-25-15-40(16-26-46)52(64)38-11-9-36(10-12-38)42-8-5-35(2)50(33-42)53(65)41-17-31-49(68)32-18-41/h3-33,68H,1-2H3 |
| InChIKey | DQSZBRNFLOOQLF-UHFFFAOYSA-N |
| XLogP | 14.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.97 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|