C17H26N- — CID 58693286
1-ethyl-2-[(1E,3E)-hexa-1,3,5-trienyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 58693286) has the molecular formula C17H26N- and a molecular weight of 244.40 g/mol. Its IUPAC name is 1-ethyl-2-[(1E,3E)-hexa-1,3,5-trienyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-ethyl-2-[(1E,3E)-hexa-1,3,5-trienyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 58693286 |
| Molecular Formula | C17H26N- |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.21 |
| IUPAC Name | 1-ethyl-2-[(1E,3E)-hexa-1,3,5-trienyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | [H]/[C-]=C/C=C/C=C/C1CCC2CCCCC2N1CC |
| InChI | InChI=1S/C17H26N/c1-3-5-6-7-11-16-14-13-15-10-8-9-12-17(15)18(16)4-2/h1,3,5-7,11,15-17H,4,8-10,12-14H2,2H3/q-1/b6-5+,11-7+ |
| InChIKey | QGMMOTIQGZPIBN-LCAICKDSSA-N |
| XLogP | 4.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|