C17H18Cl2NO3- — CID 58693338
2,6-dichloro-4-(3-heptoxy-2-isocyano-3-oxoprop-1-enyl)phenolate (PubChem CID 58693338) has the molecular formula C17H18Cl2NO3- and a molecular weight of 355.24 g/mol. Its IUPAC name is 2,6-dichloro-4-(3-heptoxy-2-isocyano-3-oxoprop-1-enyl)phenolate.
| Compound Name | 2,6-dichloro-4-(3-heptoxy-2-isocyano-3-oxoprop-1-enyl)phenolate |
|---|---|
| PubChem CID | 58693338 |
| Molecular Formula | C17H18Cl2NO3- |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2,6-dichloro-4-(3-heptoxy-2-isocyano-3-oxoprop-1-enyl)phenolate |
| SMILES | [C-]#[N+]C(=Cc1cc(Cl)c([O-])c(Cl)c1)C(=O)OCCCCCCC |
| InChI | InChI=1S/C17H19Cl2NO3/c1-3-4-5-6-7-8-23-17(22)15(20-2)11-12-9-13(18)16(21)14(19)10-12/h9-11,21H,3-8H2,1H3/p-1 |
| InChIKey | HUTRSMTVYFEAKR-UHFFFAOYSA-M |
| XLogP | 4.84 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|