C17H34N2O11 — CID 58693661
tert-butyl N-[(3R,4R)-4-[(2S,4R,5R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,5,6-tetrahydroxyhexan-2-yl]carbamate (PubChem CID 58693661) has the molecular formula C17H34N2O11 and a molecular weight of 442.46 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-4-[(2S,4R,5R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,5,6-tetrahydroxyhexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-4-[(2S,4R,5R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,5,6-tetrahydroxyhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 58693661 |
| Molecular Formula | C17H34N2O11 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | tert-butyl N-[(3R,4R)-4-[(2S,4R,5R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,3,5,6-tetrahydroxyhexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO)[C@@H](O)[C@@H](O[C@@H]1OC(CO)[C@H](O)[C@H](O)C1N)C(O)CO |
| InChI | InChI=1S/C17H34N2O11/c1-17(2,3)30-16(27)19-7(4-20)11(24)14(8(23)5-21)29-15-10(18)13(26)12(25)9(6-22)28-15/h7-15,20-26H,4-6,18H2,1-3H3,(H,19,27)/t7?,8?,9?,10?,11-,12+,13-,14+,15+/m1/s1 |
| InChIKey | UXGOTCCNHUIERD-NTPUIJBQSA-N |
| XLogP | -4.26 |
| TPSA | 224.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | -4.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |