About (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate
(4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate (PubChem CID 58694126) has the molecular formula C25H20BrN3O3
and a molecular weight of 490.36 g/mol. Its IUPAC name is (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
| PubChem CID | 58694126 |
| Molecular Formula | C25H20BrN3O3 |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate |
| SMILES | CCn1c(-c2cccc(NC(=O)Oc3ccc(Br)cc3)c2)c(C#N)c2ccc(OC)cc21 |
| InChI | InChI=1S/C25H20BrN3O3/c1-3-29-23-14-20(31-2)11-12-21(23)22(15-27)24(29)16-5-4-6-18(13-16)28-25(30)32-19-9-7-17(26)8-10-19/h4-14H,3H2,1-2H3,(H,28,30) |
| InChIKey | OKEDZJRHRZTKNA-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate?
The IUPAC name of (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate (CID 58694126) is (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate.
What is the SMILES notation for (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate?
The canonical SMILES for (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate is CCn1c(-c2cccc(NC(=O)Oc3ccc(Br)cc3)c2)c(C#N)c2ccc(OC)cc21.
What is the InChIKey of (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate?
The InChIKey is OKEDZJRHRZTKNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20BrN3O3/c1-3-29-23-14-20(31-2)11-12-21(23)22(15-27)24(29)16-5-4-6-18(13-16)28-25(30)32-19-9-7-17(26)8-10-19/h4-14H,3H2,1-2H3,(H,28,30).
What are the key properties of (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate?
(4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate has a molecular weight of 490.36 g/mol, XLogP of 6.58, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl) N-[3-(3-cyano-1-ethyl-6-methoxyindol-2-yl)phenyl]carbamate is sourced from PubChem (CID 58694126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).