C8H4F12O3 — CID 58695024
2,3,3-trifluoro-3-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(fluoromethoxy)ethoxy]ethoxy]prop-1-ene (PubChem CID 58695024) has the molecular formula C8H4F12O3 and a molecular weight of 376.09 g/mol. Its IUPAC name is 2,3,3-trifluoro-3-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(fluoromethoxy)ethoxy]ethoxy]prop-1-ene.
| Compound Name | 2,3,3-trifluoro-3-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(fluoromethoxy)ethoxy]ethoxy]prop-1-ene |
|---|---|
| PubChem CID | 58695024 |
| Molecular Formula | C8H4F12O3 |
| Molecular Weight | 376.09 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 2,3,3-trifluoro-3-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(fluoromethoxy)ethoxy]ethoxy]prop-1-ene |
| SMILES | C=C(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OCF |
| InChI | InChI=1S/C8H4F12O3/c1-3(10)4(11,12)22-7(17,18)8(19,20)23-6(15,16)5(13,14)21-2-9/h1-2H2 |
| InChIKey | NXGUYGVJPCOWQS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.09 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|