C30H47O3 — CID 58695223
CID 58695223 (PubChem CID 58695223) has the molecular formula C30H47O3 and a molecular weight of 455.70 g/mol.
| Compound Name | CID 58695223 |
|---|---|
| PubChem CID | 58695223 |
| Molecular Formula | C30H47O3 |
| Molecular Weight | 455.70 g/mol |
| Exact Mass | 455.35 |
| IUPAC Name | — |
| SMILES | CC1(C)[CH]C2C3=CCC4[C@@]5(C)CC[C@H](O)C(C)(C)C5CC[C@@]4(C)[C@]3(C)CC[C@@]2(C(=O)O)CC1 |
| InChI | InChI=1S/C30H47O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8,18,20-23,31H,9-17H2,1-7H3,(H,32,33)/t20?,21?,22?,23-,27-,28+,29+,30-/m0/s1 |
| InChIKey | XRRWKVJOXUONTG-FQRDBSNUSA-N |
| XLogP | 7.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.70 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|