About iridium;2-phenyl-3,4-dihydropyridine
iridium;2-phenyl-3,4-dihydropyridine (PubChem CID 58695375) has the molecular formula C11H10IrN-
and a molecular weight of 348.43 g/mol. Its IUPAC name is iridium;2-phenyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | iridium;2-phenyl-3,4-dihydropyridine |
| PubChem CID | 58695375 |
| Molecular Formula | C11H10IrN- |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | iridium;2-phenyl-3,4-dihydropyridine |
| SMILES | [Ir].[c-]1ccccc1C1=NC=CCC1 |
| InChI | InChI=1S/C11H10N.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-3,5-6,9H,4,8H2;/q-1; |
| InChIKey | KAJYOSVRTDCIMB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;2-phenyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;2-phenyl-3,4-dihydropyridine?
The IUPAC name of iridium;2-phenyl-3,4-dihydropyridine (CID 58695375) is iridium;2-phenyl-3,4-dihydropyridine.
What is the SMILES notation for iridium;2-phenyl-3,4-dihydropyridine?
The canonical SMILES for iridium;2-phenyl-3,4-dihydropyridine is [Ir].[c-]1ccccc1C1=NC=CCC1.
What is the InChIKey of iridium;2-phenyl-3,4-dihydropyridine?
The InChIKey is KAJYOSVRTDCIMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-3,5-6,9H,4,8H2;/q-1;.
What are the key properties of iridium;2-phenyl-3,4-dihydropyridine?
iridium;2-phenyl-3,4-dihydropyridine has a molecular weight of 348.43 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;2-phenyl-3,4-dihydropyridine is sourced from PubChem (CID 58695375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).