About 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate
5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate (PubChem CID 58695621) has the molecular formula C15H25N3O7
and a molecular weight of 359.38 g/mol. Its IUPAC name is 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate.
Molecular Properties
| Compound Name | 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate |
| PubChem CID | 58695621 |
| Molecular Formula | C15H25N3O7 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate |
| SMILES | C=CCOC(=O)C(CCC(=O)OC)NC(=O)C(COC)NC(=O)CN |
| InChI | InChI=1S/C15H25N3O7/c1-4-7-25-15(22)10(5-6-13(20)24-3)18-14(21)11(9-23-2)17-12(19)8-16/h4,10-11H,1,5-9,16H2,2-3H3,(H,17,19)(H,18,21) |
| InChIKey | NMLCEYKCSMILOJ-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate?
The IUPAC name of 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate (CID 58695621) is 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate.
What is the SMILES notation for 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate?
The canonical SMILES for 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate is C=CCOC(=O)C(CCC(=O)OC)NC(=O)C(COC)NC(=O)CN.
What is the InChIKey of 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate?
The InChIKey is NMLCEYKCSMILOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O7/c1-4-7-25-15(22)10(5-6-13(20)24-3)18-14(21)11(9-23-2)17-12(19)8-16/h4,10-11H,1,5-9,16H2,2-3H3,(H,17,19)(H,18,21).
What are the key properties of 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate?
5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate has a molecular weight of 359.38 g/mol, XLogP of -1.76, 12 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-methyl 1-O-prop-2-enyl 2-[[2-[(2-aminoacetyl)amino]-3-methoxypropanoyl]amino]pentanedioate is sourced from PubChem (CID 58695621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).