About 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate
5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate (PubChem CID 58695627) has the molecular formula C13H22N2O6
and a molecular weight of 302.33 g/mol. Its IUPAC name is 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate.
Molecular Properties
| Compound Name | 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate |
| PubChem CID | 58695627 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate |
| SMILES | C=CCOC(=O)C(CCC(=O)OC)NC(=O)C(N)COC |
| InChI | InChI=1S/C13H22N2O6/c1-4-7-21-13(18)10(5-6-11(16)20-3)15-12(17)9(14)8-19-2/h4,9-10H,1,5-8,14H2,2-3H3,(H,15,17) |
| InChIKey | AXTDRPKLUUHPCS-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate?
The IUPAC name of 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate (CID 58695627) is 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate.
What is the SMILES notation for 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate?
The canonical SMILES for 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate is C=CCOC(=O)C(CCC(=O)OC)NC(=O)C(N)COC.
What is the InChIKey of 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate?
The InChIKey is AXTDRPKLUUHPCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O6/c1-4-7-21-13(18)10(5-6-11(16)20-3)15-12(17)9(14)8-19-2/h4,9-10H,1,5-8,14H2,2-3H3,(H,15,17).
What are the key properties of 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate?
5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate has a molecular weight of 302.33 g/mol, XLogP of -0.87, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-methyl 1-O-prop-2-enyl 2-[(2-amino-3-methoxypropanoyl)amino]pentanedioate is sourced from PubChem (CID 58695627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).