C17H25NO4 — CID 58695815
3-cyclohex-2-en-1-yl-8-ethoxycarbonyl-8-azabicyclo[3.2.1]octane-3-carboxylic acid (PubChem CID 58695815) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-cyclohex-2-en-1-yl-8-ethoxycarbonyl-8-azabicyclo[3.2.1]octane-3-carboxylic acid.
| Compound Name | 3-cyclohex-2-en-1-yl-8-ethoxycarbonyl-8-azabicyclo[3.2.1]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 58695815 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 3-cyclohex-2-en-1-yl-8-ethoxycarbonyl-8-azabicyclo[3.2.1]octane-3-carboxylic acid |
| SMILES | CCOC(=O)N1C2CCC1CC(C(=O)O)(C1C=CCCC1)C2 |
| InChI | InChI=1S/C17H25NO4/c1-2-22-16(21)18-13-8-9-14(18)11-17(10-13,15(19)20)12-6-4-3-5-7-12/h4,6,12-14H,2-3,5,7-11H2,1H3,(H,19,20) |
| InChIKey | XGSCGXOSJNCLPA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|