About 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine
2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine (PubChem CID 58695851) has the molecular formula C11H18N4S
and a molecular weight of 238.36 g/mol. Its IUPAC name is 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine.
Molecular Properties
| Compound Name | 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine |
| PubChem CID | 58695851 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine |
| SMILES | CC[C@@]1(C)CCCc2sc(N=C(N)N)nc21 |
| InChI | InChI=1S/C11H18N4S/c1-3-11(2)6-4-5-7-8(11)14-10(16-7)15-9(12)13/h3-6H2,1-2H3,(H4,12,13,14,15)/t11-/m0/s1 |
| InChIKey | QSOMFWDDWOFLBS-NSHDSACASA-N |
| XLogP | 2.05 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine?
The IUPAC name of 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine (CID 58695851) is 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine.
What is the SMILES notation for 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine?
The canonical SMILES for 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine is CC[C@@]1(C)CCCc2sc(N=C(N)N)nc21.
What is the InChIKey of 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine?
The InChIKey is QSOMFWDDWOFLBS-NSHDSACASA-N. The full InChI is InChI=1S/C11H18N4S/c1-3-11(2)6-4-5-7-8(11)14-10(16-7)15-9(12)13/h3-6H2,1-2H3,(H4,12,13,14,15)/t11-/m0/s1.
What are the key properties of 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine?
2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine has a molecular weight of 238.36 g/mol, XLogP of 2.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-4-ethyl-4-methyl-6,7-dihydro-5H-1,3-benzothiazol-2-yl]guanidine is sourced from PubChem (CID 58695851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).