C12H17N5OS — CID 58695909
(6S)-2-(diaminomethylideneamino)-N-prop-2-enyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide (PubChem CID 58695909) has the molecular formula C12H17N5OS and a molecular weight of 279.37 g/mol. Its IUPAC name is (6S)-2-(diaminomethylideneamino)-N-prop-2-enyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide.
| Compound Name | (6S)-2-(diaminomethylideneamino)-N-prop-2-enyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 58695909 |
| Molecular Formula | C12H17N5OS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (6S)-2-(diaminomethylideneamino)-N-prop-2-enyl-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
| SMILES | C=CCNC(=O)[C@H]1CCc2nc(N=C(N)N)sc2C1 |
| InChI | InChI=1S/C12H17N5OS/c1-2-5-15-10(18)7-3-4-8-9(6-7)19-12(16-8)17-11(13)14/h2,7H,1,3-6H2,(H,15,18)(H4,13,14,16,17)/t7-/m0/s1 |
| InChIKey | IIYIRWDHKMHWMJ-ZETCQYMHSA-N |
| XLogP | 0.46 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|