C22H27F5N2O5S — CID 58696070
(2R,3R,4S,5S,6R)-2-[1-(1,3-difluoropropan-2-yl)-4-[(4-ethylphenyl)methyl]-5-(trifluoromethyl)pyrazol-3-yl]oxy-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 58696070) has the molecular formula C22H27F5N2O5S and a molecular weight of 526.52 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[1-(1,3-difluoropropan-2-yl)-4-[(4-ethylphenyl)methyl]-5-(trifluoromethyl)pyrazol-3-yl]oxy-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[1-(1,3-difluoropropan-2-yl)-4-[(4-ethylphenyl)methyl]-5-(trifluoromethyl)pyrazol-3-yl]oxy-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 58696070 |
| Molecular Formula | C22H27F5N2O5S |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[1-(1,3-difluoropropan-2-yl)-4-[(4-ethylphenyl)methyl]-5-(trifluoromethyl)pyrazol-3-yl]oxy-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2c(O[C@@H]3S[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)nn(C(CF)CF)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H27F5N2O5S/c1-2-11-3-5-12(6-4-11)7-14-19(22(25,26)27)29(13(8-23)9-24)28-20(14)34-21-18(33)17(32)16(31)15(10-30)35-21/h3-6,13,15-18,21,30-33H,2,7-10H2,1H3/t15-,16-,17+,18-,21-/m1/s1 |
| InChIKey | DRWFIZPBYQJHDU-ZIKOTGLESA-N |
| XLogP | 2.43 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |