About tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate
tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate (PubChem CID 58696293) has the molecular formula C17H23Cl2NO3
and a molecular weight of 360.28 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate |
| PubChem CID | 58696293 |
| Molecular Formula | C17H23Cl2NO3 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate |
| SMILES | C=CC[C@@](CO)(c1ccc(Cl)c(Cl)c1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23Cl2NO3/c1-6-9-17(11-21,12-7-8-13(18)14(19)10-12)20(5)15(22)23-16(2,3)4/h6-8,10,21H,1,9,11H2,2-5H3/t17-/m1/s1 |
| InChIKey | RFNQUKXFUXHLAB-QGZVFWFLSA-N |
| XLogP | 4.62 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate (CID 58696293) is tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate is C=CC[C@@](CO)(c1ccc(Cl)c(Cl)c1)N(C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate?
The InChIKey is RFNQUKXFUXHLAB-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H23Cl2NO3/c1-6-9-17(11-21,12-7-8-13(18)14(19)10-12)20(5)15(22)23-16(2,3)4/h6-8,10,21H,1,9,11H2,2-5H3/t17-/m1/s1.
What are the key properties of tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate?
tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate has a molecular weight of 360.28 g/mol, XLogP of 4.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S)-2-(3,4-dichlorophenyl)-1-hydroxypent-4-en-2-yl]-N-methylcarbamate is sourced from PubChem (CID 58696293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).