C35H36Cl2F3N5O4 — CID 58696380
N'-[(2S)-2-(3,4-dichlorophenyl)-1-[methyl-(2,2,2-trifluoroacetyl)amino]-4-(3-oxospiro[2,4-dihydroisoquinoline-1,4'-piperidine]-1'-yl)butan-2-yl]-N'-methyl-N-phenyloxamide (PubChem CID 58696380) has the molecular formula C35H36Cl2F3N5O4 and a molecular weight of 718.60 g/mol. Its IUPAC name is N'-[(2S)-2-(3,4-dichlorophenyl)-1-[methyl-(2,2,2-trifluoroacetyl)amino]-4-(3-oxospiro[2,4-dihydroisoquinoline-1,4'-piperidine]-1'-yl)butan-2-yl]-N'-methyl-N-phenyloxamide.
| Compound Name | N'-[(2S)-2-(3,4-dichlorophenyl)-1-[methyl-(2,2,2-trifluoroacetyl)amino]-4-(3-oxospiro[2,4-dihydroisoquinoline-1,4'-piperidine]-1'-yl)butan-2-yl]-N'-methyl-N-phenyloxamide |
|---|---|
| PubChem CID | 58696380 |
| Molecular Formula | C35H36Cl2F3N5O4 |
| Molecular Weight | 718.60 g/mol |
| Exact Mass | 717.21 |
| IUPAC Name | N'-[(2S)-2-(3,4-dichlorophenyl)-1-[methyl-(2,2,2-trifluoroacetyl)amino]-4-(3-oxospiro[2,4-dihydroisoquinoline-1,4'-piperidine]-1'-yl)butan-2-yl]-N'-methyl-N-phenyloxamide |
| SMILES | CN(C[C@](CCN1CCC2(CC1)NC(=O)Cc1ccccc12)(c1ccc(Cl)c(Cl)c1)N(C)C(=O)C(=O)Nc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C35H36Cl2F3N5O4/c1-43(32(49)35(38,39)40)22-34(24-12-13-27(36)28(37)21-24,44(2)31(48)30(47)41-25-9-4-3-5-10-25)16-19-45-17-14-33(15-18-45)26-11-7-6-8-23(26)20-29(46)42-33/h3-13,21H,14-20,22H2,1-2H3,(H,41,47)(H,42,46)/t34-/m1/s1 |
| InChIKey | GZTAKNKXSAEFOG-UUWRZZSWSA-N |
| XLogP | 5.36 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|