About diethyl [(Z)-hept-2-en-3-yl] phosphate
diethyl [(Z)-hept-2-en-3-yl] phosphate (PubChem CID 58696439) has the molecular formula C11H23O4P
and a molecular weight of 250.27 g/mol. Its IUPAC name is diethyl [(Z)-hept-2-en-3-yl] phosphate.
Molecular Properties
| Compound Name | diethyl [(Z)-hept-2-en-3-yl] phosphate |
| PubChem CID | 58696439 |
| Molecular Formula | C11H23O4P |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | diethyl [(Z)-hept-2-en-3-yl] phosphate |
| SMILES | C/C=C(/CCCC)OP(=O)(OCC)OCC |
| InChI | InChI=1S/C11H23O4P/c1-5-9-10-11(6-2)15-16(12,13-7-3)14-8-4/h6H,5,7-10H2,1-4H3/b11-6- |
| InChIKey | QOORRHPNWCDZKP-WDZFZDKYSA-N |
| XLogP | 4.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl [(Z)-hept-2-en-3-yl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl [(Z)-hept-2-en-3-yl] phosphate?
The IUPAC name of diethyl [(Z)-hept-2-en-3-yl] phosphate (CID 58696439) is diethyl [(Z)-hept-2-en-3-yl] phosphate.
What is the SMILES notation for diethyl [(Z)-hept-2-en-3-yl] phosphate?
The canonical SMILES for diethyl [(Z)-hept-2-en-3-yl] phosphate is C/C=C(/CCCC)OP(=O)(OCC)OCC.
What is the InChIKey of diethyl [(Z)-hept-2-en-3-yl] phosphate?
The InChIKey is QOORRHPNWCDZKP-WDZFZDKYSA-N. The full InChI is InChI=1S/C11H23O4P/c1-5-9-10-11(6-2)15-16(12,13-7-3)14-8-4/h6H,5,7-10H2,1-4H3/b11-6-.
What are the key properties of diethyl [(Z)-hept-2-en-3-yl] phosphate?
diethyl [(Z)-hept-2-en-3-yl] phosphate has a molecular weight of 250.27 g/mol, XLogP of 4.28, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl [(Z)-hept-2-en-3-yl] phosphate is sourced from PubChem (CID 58696439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).