About (Z)-4-iodohept-3-ene
(Z)-4-iodohept-3-ene (PubChem CID 58696452) has the molecular formula C7H13I
and a molecular weight of 224.08 g/mol. Its IUPAC name is (Z)-4-iodohept-3-ene.
Molecular Properties
| Compound Name | (Z)-4-iodohept-3-ene |
| PubChem CID | 58696452 |
| Molecular Formula | C7H13I |
| Molecular Weight | 224.08 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | (Z)-4-iodohept-3-ene |
| SMILES | CC/C=C(\I)CCC |
| InChI | InChI=1S/C7H13I/c1-3-5-7(8)6-4-2/h5H,3-4,6H2,1-2H3/b7-5- |
| InChIKey | VBSLPICMWKNIKI-ALCCZGGFSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.08 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-iodohept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-iodohept-3-ene?
The IUPAC name of (Z)-4-iodohept-3-ene (CID 58696452) is (Z)-4-iodohept-3-ene.
What is the SMILES notation for (Z)-4-iodohept-3-ene?
The canonical SMILES for (Z)-4-iodohept-3-ene is CC/C=C(\I)CCC.
What is the InChIKey of (Z)-4-iodohept-3-ene?
The InChIKey is VBSLPICMWKNIKI-ALCCZGGFSA-N. The full InChI is InChI=1S/C7H13I/c1-3-5-7(8)6-4-2/h5H,3-4,6H2,1-2H3/b7-5-.
What are the key properties of (Z)-4-iodohept-3-ene?
(Z)-4-iodohept-3-ene has a molecular weight of 224.08 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-iodohept-3-ene is sourced from PubChem (CID 58696452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).