C29H42F2O5 — CID 58696565
benzyl 9-[(1R,2R,3R)-2-(4,4-difluoro-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]nonanoate (PubChem CID 58696565) has the molecular formula C29H42F2O5 and a molecular weight of 508.65 g/mol. Its IUPAC name is benzyl 9-[(1R,2R,3R)-2-(4,4-difluoro-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]nonanoate.
| Compound Name | benzyl 9-[(1R,2R,3R)-2-(4,4-difluoro-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]nonanoate |
|---|---|
| PubChem CID | 58696565 |
| Molecular Formula | C29H42F2O5 |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | benzyl 9-[(1R,2R,3R)-2-(4,4-difluoro-3-oxooctyl)-3-hydroxy-5-oxocyclopentyl]nonanoate |
| SMILES | CCCCC(F)(F)C(=O)CC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H42F2O5/c1-2-3-19-29(30,31)27(34)18-17-24-23(25(32)20-26(24)33)15-11-6-4-5-7-12-16-28(35)36-21-22-13-9-8-10-14-22/h8-10,13-14,23-24,26,33H,2-7,11-12,15-21H2,1H3/t23-,24-,26-/m1/s1 |
| InChIKey | RZBWFKNOBHCSAL-DGWZTRNLSA-N |
| XLogP | 6.59 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|