About methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate
methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate (PubChem CID 58696583) has the molecular formula C22H42O5Si
and a molecular weight of 414.66 g/mol. Its IUPAC name is methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate |
| PubChem CID | 58696583 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCCC1[C@@H](CO[Si](C)(C)C(C)(C)C)CC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H42O5Si/c1-17(23)27-20-15-14-18(16-26-28(6,7)22(2,3)4)19(20)12-10-8-9-11-13-21(24)25-5/h18-20H,8-16H2,1-7H3/t18-,19?,20+/m1/s1 |
| InChIKey | DOSBKBYPQIWKOH-ITIDOPETSA-N |
| XLogP | 5.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate?
The IUPAC name of methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate (CID 58696583) is methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate.
What is the SMILES notation for methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate?
The canonical SMILES for methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate is COC(=O)CCCCCCC1[C@@H](CO[Si](C)(C)C(C)(C)C)CC[C@@H]1OC(C)=O.
What is the InChIKey of methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate?
The InChIKey is DOSBKBYPQIWKOH-ITIDOPETSA-N. The full InChI is InChI=1S/C22H42O5Si/c1-17(23)27-20-15-14-18(16-26-28(6,7)22(2,3)4)19(20)12-10-8-9-11-13-21(24)25-5/h18-20H,8-16H2,1-7H3/t18-,19?,20+/m1/s1.
What are the key properties of methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate?
methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate has a molecular weight of 414.66 g/mol, XLogP of 5.48, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(2S,5S)-2-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]heptanoate is sourced from PubChem (CID 58696583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).