C10H13Cl2F3O4 — CID 58696604
[4-(1,2-dichloroethyl)-2-methyl-1,3-dioxolan-2-yl]methyl 3,3,3-trifluoropropanoate (PubChem CID 58696604) has the molecular formula C10H13Cl2F3O4 and a molecular weight of 325.11 g/mol. Its IUPAC name is [4-(1,2-dichloroethyl)-2-methyl-1,3-dioxolan-2-yl]methyl 3,3,3-trifluoropropanoate.
| Compound Name | [4-(1,2-dichloroethyl)-2-methyl-1,3-dioxolan-2-yl]methyl 3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 58696604 |
| Molecular Formula | C10H13Cl2F3O4 |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | [4-(1,2-dichloroethyl)-2-methyl-1,3-dioxolan-2-yl]methyl 3,3,3-trifluoropropanoate |
| SMILES | CC1(COC(=O)CC(F)(F)F)OCC(C(Cl)CCl)O1 |
| InChI | InChI=1S/C10H13Cl2F3O4/c1-9(5-17-8(16)2-10(13,14)15)18-4-7(19-9)6(12)3-11/h6-7H,2-5H2,1H3 |
| InChIKey | GBQKSDMKYAPWAE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|