About azanide;3-methyl-3-(propoxymethyl)pentane;yttrium
azanide;3-methyl-3-(propoxymethyl)pentane;yttrium (PubChem CID 58696673) has the molecular formula C10H23NOY-2
and a molecular weight of 262.21 g/mol. Its IUPAC name is azanide;3-methyl-3-(propoxymethyl)pentane;yttrium.
Molecular Properties
| Compound Name | azanide;3-methyl-3-(propoxymethyl)pentane;yttrium |
| PubChem CID | 58696673 |
| Molecular Formula | C10H23NOY-2 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | azanide;3-methyl-3-(propoxymethyl)pentane;yttrium |
| SMILES | C[CH-]COCC(C)(CC)CC.[NH2-].[Y] |
| InChI | InChI=1S/C10H21O.H2N.Y/c1-5-8-11-9-10(4,6-2)7-3;;/h5H,6-9H2,1-4H3;1H2;/q2*-1; |
| InChIKey | QRWMGGHVFCRJHF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze azanide;3-methyl-3-(propoxymethyl)pentane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;3-methyl-3-(propoxymethyl)pentane;yttrium?
The IUPAC name of azanide;3-methyl-3-(propoxymethyl)pentane;yttrium (CID 58696673) is azanide;3-methyl-3-(propoxymethyl)pentane;yttrium.
What is the SMILES notation for azanide;3-methyl-3-(propoxymethyl)pentane;yttrium?
The canonical SMILES for azanide;3-methyl-3-(propoxymethyl)pentane;yttrium is C[CH-]COCC(C)(CC)CC.[NH2-].[Y].
What is the InChIKey of azanide;3-methyl-3-(propoxymethyl)pentane;yttrium?
The InChIKey is QRWMGGHVFCRJHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21O.H2N.Y/c1-5-8-11-9-10(4,6-2)7-3;;/h5H,6-9H2,1-4H3;1H2;/q2*-1;.
What are the key properties of azanide;3-methyl-3-(propoxymethyl)pentane;yttrium?
azanide;3-methyl-3-(propoxymethyl)pentane;yttrium has a molecular weight of 262.21 g/mol, XLogP of 3.77, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;3-methyl-3-(propoxymethyl)pentane;yttrium is sourced from PubChem (CID 58696673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).