C9H16Br2O — CID 58696769
(2R,3S,5R)-2-bromo-2-(bromomethyl)-5-ethyl-3,4-dimethyloxolane (PubChem CID 58696769) has the molecular formula C9H16Br2O and a molecular weight of 300.03 g/mol. Its IUPAC name is (2R,3S,5R)-2-bromo-2-(bromomethyl)-5-ethyl-3,4-dimethyloxolane.
| Compound Name | (2R,3S,5R)-2-bromo-2-(bromomethyl)-5-ethyl-3,4-dimethyloxolane |
|---|---|
| PubChem CID | 58696769 |
| Molecular Formula | C9H16Br2O |
| Molecular Weight | 300.03 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | (2R,3S,5R)-2-bromo-2-(bromomethyl)-5-ethyl-3,4-dimethyloxolane |
| SMILES | CC[C@H]1O[C@](Br)(CBr)[C@@H](C)C1C |
| InChI | InChI=1S/C9H16Br2O/c1-4-8-6(2)7(3)9(11,5-10)12-8/h6-8H,4-5H2,1-3H3/t6?,7-,8+,9+/m0/s1 |
| InChIKey | GCYMLYUEDAHQQC-GSLILNRNSA-N |
| XLogP | 3.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.03 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|