C34H34N2O4S2 — CID 58697421
2-[2-[3-methyl-5-[1-(3-methylsulfanylpropyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonate (PubChem CID 58697421) has the molecular formula C34H34N2O4S2 and a molecular weight of 598.79 g/mol. Its IUPAC name is 2-[2-[3-methyl-5-[1-(3-methylsulfanylpropyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonate.
| Compound Name | 2-[2-[3-methyl-5-[1-(3-methylsulfanylpropyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonate |
|---|---|
| PubChem CID | 58697421 |
| Molecular Formula | C34H34N2O4S2 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 2-[2-[3-methyl-5-[1-(3-methylsulfanylpropyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonate |
| SMILES | CSCCC[n+]1ccc(C=CC(C)=CC=C2Oc3ccc(-c4ccccc4)cc3N2CCS(=O)(=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C34H34N2O4S2/c1-26(13-15-28-19-21-35(20-8-23-41-2)31-12-7-6-11-30(28)31)14-18-34-36(22-24-42(37,38)39)32-25-29(16-17-33(32)40-34)27-9-4-3-5-10-27/h3-7,9-19,21,25H,8,20,22-24H2,1-2H3 |
| InChIKey | FKWHMHLMKQGCPV-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|