C34H35N2O4S2+ — CID 58697422
2-[2-[3-methyl-5-[1-(3-methylsulfanylpropyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonic acid (PubChem CID 58697422) has the molecular formula C34H35N2O4S2+ and a molecular weight of 599.80 g/mol. Its IUPAC name is 2-[2-[3-methyl-5-[1-(3-methylsulfanylpropyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonic acid.
| Compound Name | 2-[2-[3-methyl-5-[1-(3-methylsulfanylpropyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 58697422 |
| Molecular Formula | C34H35N2O4S2+ |
| Molecular Weight | 599.80 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 2-[2-[3-methyl-5-[1-(3-methylsulfanylpropyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]-5-phenyl-1,3-benzoxazol-3-yl]ethanesulfonic acid |
| SMILES | CSCCC[n+]1ccc(C=CC(C)=CC=C2Oc3ccc(-c4ccccc4)cc3N2CCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C34H34N2O4S2/c1-26(13-15-28-19-21-35(20-8-23-41-2)31-12-7-6-11-30(28)31)14-18-34-36(22-24-42(37,38)39)32-25-29(16-17-33(32)40-34)27-9-4-3-5-10-27/h3-7,9-19,21,25H,8,20,22-24H2,1-2H3/p+1 |
| InChIKey | FKWHMHLMKQGCPV-UHFFFAOYSA-O |
| XLogP | 7.14 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.80 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|