About 2,6-dimethylbenzene-4-id-1-amine;yttrium
2,6-dimethylbenzene-4-id-1-amine;yttrium (PubChem CID 58697474) has the molecular formula C8H10NY-
and a molecular weight of 209.08 g/mol. Its IUPAC name is 2,6-dimethylbenzene-4-id-1-amine;yttrium.
Molecular Properties
| Compound Name | 2,6-dimethylbenzene-4-id-1-amine;yttrium |
| PubChem CID | 58697474 |
| Molecular Formula | C8H10NY- |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 208.99 |
| IUPAC Name | 2,6-dimethylbenzene-4-id-1-amine;yttrium |
| SMILES | Cc1c[c-]cc(C)c1N.[Y] |
| InChI | InChI=1S/C8H10N.Y/c1-6-4-3-5-7(2)8(6)9;/h4-5H,9H2,1-2H3;/q-1; |
| InChIKey | ZSDDHLWQVMQLER-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylbenzene-4-id-1-amine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylbenzene-4-id-1-amine;yttrium?
The IUPAC name of 2,6-dimethylbenzene-4-id-1-amine;yttrium (CID 58697474) is 2,6-dimethylbenzene-4-id-1-amine;yttrium.
What is the SMILES notation for 2,6-dimethylbenzene-4-id-1-amine;yttrium?
The canonical SMILES for 2,6-dimethylbenzene-4-id-1-amine;yttrium is Cc1c[c-]cc(C)c1N.[Y].
What is the InChIKey of 2,6-dimethylbenzene-4-id-1-amine;yttrium?
The InChIKey is ZSDDHLWQVMQLER-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N.Y/c1-6-4-3-5-7(2)8(6)9;/h4-5H,9H2,1-2H3;/q-1;.
What are the key properties of 2,6-dimethylbenzene-4-id-1-amine;yttrium?
2,6-dimethylbenzene-4-id-1-amine;yttrium has a molecular weight of 209.08 g/mol, XLogP of 1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylbenzene-4-id-1-amine;yttrium is sourced from PubChem (CID 58697474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).