About 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile
4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile (PubChem CID 58698636) has the molecular formula C30H25F2N
and a molecular weight of 437.53 g/mol. Its IUPAC name is 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile |
| PubChem CID | 58698636 |
| Molecular Formula | C30H25F2N |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile |
| SMILES | C[C@@H](Cc1c(F)cc(CCc2ccc(-c3ccc(C#N)cc3)cc2)cc1F)c1ccccc1 |
| InChI | InChI=1S/C30H25F2N/c1-21(25-5-3-2-4-6-25)17-28-29(31)18-24(19-30(28)32)8-7-22-9-13-26(14-10-22)27-15-11-23(20-33)12-16-27/h2-6,9-16,18-19,21H,7-8,17H2,1H3/t21-/m0/s1 |
| InChIKey | LBENJZWRBUBSFR-NRFANRHFSA-N |
| XLogP | 7.63 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile?
The IUPAC name of 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile (CID 58698636) is 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile.
What is the SMILES notation for 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile?
The canonical SMILES for 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile is C[C@@H](Cc1c(F)cc(CCc2ccc(-c3ccc(C#N)cc3)cc2)cc1F)c1ccccc1.
What is the InChIKey of 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile?
The InChIKey is LBENJZWRBUBSFR-NRFANRHFSA-N. The full InChI is InChI=1S/C30H25F2N/c1-21(25-5-3-2-4-6-25)17-28-29(31)18-24(19-30(28)32)8-7-22-9-13-26(14-10-22)27-15-11-23(20-33)12-16-27/h2-6,9-16,18-19,21H,7-8,17H2,1H3/t21-/m0/s1.
What are the key properties of 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile?
4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile has a molecular weight of 437.53 g/mol, XLogP of 7.63, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[2-[3,5-difluoro-4-[(2S)-2-phenylpropyl]phenyl]ethyl]phenyl]benzonitrile is sourced from PubChem (CID 58698636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).