C34H38F2 — CID 58698946
1-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-4-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene (PubChem CID 58698946) has the molecular formula C34H38F2 and a molecular weight of 484.67 g/mol. Its IUPAC name is 1-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-4-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene.
| Compound Name | 1-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-4-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 58698946 |
| Molecular Formula | C34H38F2 |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 1-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-4-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene |
| SMILES | CCCC1CCC(/C(F)=C(\F)c2ccc(C=Cc3ccc(C[C@@H](C)c4ccccc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C34H38F2/c1-3-7-26-16-20-31(21-17-26)33(35)34(36)32-22-18-28(19-23-32)11-10-27-12-14-29(15-13-27)24-25(2)30-8-5-4-6-9-30/h4-6,8-15,18-19,22-23,25-26,31H,3,7,16-17,20-21,24H2,1-2H3/b11-10?,34-33+/t25-,26?,31?/m1/s1 |
| InChIKey | CBDWQVRHNPAFOY-LYMCBRAWSA-N |
| XLogP | 10.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|