C12H14N4O2 — CID 586998
N-[2-(3-methylphenoxy)ethyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 586998) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is N-[2-(3-methylphenoxy)ethyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[2-(3-methylphenoxy)ethyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 586998 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | N-[2-(3-methylphenoxy)ethyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Cc1cccc(OCCNC(=O)c2ncn[nH]2)c1 |
| InChI | InChI=1S/C12H14N4O2/c1-9-3-2-4-10(7-9)18-6-5-13-12(17)11-14-8-15-16-11/h2-4,7-8H,5-6H2,1H3,(H,13,17)(H,14,15,16) |
| InChIKey | NRBQTYGTSXZAJI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|