C13H20N3Rb — CID 58699950
rubidium(1+);3-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]benzene-4-id-1-amine (PubChem CID 58699950) has the molecular formula C13H20N3Rb and a molecular weight of 303.79 g/mol. Its IUPAC name is rubidium(1+);3-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]benzene-4-id-1-amine.
| Compound Name | rubidium(1+);3-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]benzene-4-id-1-amine |
|---|---|
| PubChem CID | 58699950 |
| Molecular Formula | C13H20N3Rb |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | rubidium(1+);3-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]benzene-4-id-1-amine |
| SMILES | C[C@@H]1CN(c2[c-]ccc(N)c2)C[C@H](C)N1C.[Rb+] |
| InChI | InChI=1S/C13H20N3.Rb/c1-10-8-16(9-11(2)15(10)3)13-6-4-5-12(14)7-13;/h4-5,7,10-11H,8-9,14H2,1-3H3;/q-1;+1/t10-,11+; |
| InChIKey | DATWOBJNOXNBHZ-NJJJQDLFSA-N |
| XLogP | -1.40 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|