C32H46O4 — CID 58700094
(1R,3E,7S,9E,11S,15S,17R)-11,15-dimethyl-7-[(E,2S)-4-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]but-3-en-2-yl]-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one (PubChem CID 58700094) has the molecular formula C32H46O4 and a molecular weight of 494.72 g/mol. Its IUPAC name is (1R,3E,7S,9E,11S,15S,17R)-11,15-dimethyl-7-[(E,2S)-4-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]but-3-en-2-yl]-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one.
| Compound Name | (1R,3E,7S,9E,11S,15S,17R)-11,15-dimethyl-7-[(E,2S)-4-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]but-3-en-2-yl]-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
|---|---|
| PubChem CID | 58700094 |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | (1R,3E,7S,9E,11S,15S,17R)-11,15-dimethyl-7-[(E,2S)-4-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]but-3-en-2-yl]-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
| SMILES | C=C1C[C@H](C)C[C@@H]2CC=C[C@@H](C/C=C/C(=O)O[C@H]([C@@H](C)/C=C/[C@@H]3CC(C)=CCO3)C/C=C/[C@@H](C)C1)O2 |
| InChI | InChI=1S/C32H46O4/c1-23-9-6-13-31(27(5)15-16-29-21-24(2)17-18-34-29)36-32(33)14-8-11-28-10-7-12-30(35-28)22-26(4)20-25(3)19-23/h6-10,14-17,23,26-31H,3,11-13,18-22H2,1-2,4-5H3/b9-6+,14-8+,16-15+/t23-,26+,27+,28+,29-,30+,31+/m1/s1 |
| InChIKey | OCOPSBZKJNVCDB-HVQQVCPZSA-N |
| XLogP | 7.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|