About CID 58700125
CID 58700125 (PubChem CID 58700125) has the molecular formula C35H54BO7P
and a molecular weight of 628.60 g/mol.
Molecular Properties
| Compound Name | CID 58700125 |
| PubChem CID | 58700125 |
| Molecular Formula | C35H54BO7P |
| Molecular Weight | 628.60 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | — |
| SMILES | [B]P(C)O[C@@H](C/C=C/[C@H](CC(=C)C[C@H](C)C[C@@H]1CC=C[C@@H](CC#CC)O1)OCOC)[C@H](/C=C/[C@@H]1CC(C)=CCO1)OCOC |
| InChI | InChI=1S/C35H54BO7P/c1-8-9-12-30-13-10-15-33(42-30)24-29(4)21-28(3)23-31(40-25-37-5)14-11-16-35(43-44(7)36)34(41-26-38-6)18-17-32-22-27(2)19-20-39-32/h10-11,13-14,17-19,29-35H,3,12,15-16,20-26H2,1-2,4-7H3/b14-11+,18-17+/t29-,30+,31+,32+,33-,34-,35-,44?/m0/s1 |
| InChIKey | DDXUGLIVXMWOEG-XHPBWXOYSA-N |
| XLogP | 7.19 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 628.60 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 58700125 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58700125?
The IUPAC name of CID 58700125 (CID 58700125) is not available.
What is the SMILES notation for CID 58700125?
The canonical SMILES for CID 58700125 is [B]P(C)O[C@@H](C/C=C/[C@H](CC(=C)C[C@H](C)C[C@@H]1CC=C[C@@H](CC#CC)O1)OCOC)[C@H](/C=C/[C@@H]1CC(C)=CCO1)OCOC.
What is the InChIKey of CID 58700125?
The InChIKey is DDXUGLIVXMWOEG-XHPBWXOYSA-N. The full InChI is InChI=1S/C35H54BO7P/c1-8-9-12-30-13-10-15-33(42-30)24-29(4)21-28(3)23-31(40-25-37-5)14-11-16-35(43-44(7)36)34(41-26-38-6)18-17-32-22-27(2)19-20-39-32/h10-11,13-14,17-19,29-35H,3,12,15-16,20-26H2,1-2,4-7H3/b14-11+,18-17+/t29-,30+,31+,32+,33-,34-,35-,44?/m0/s1.
What are the key properties of CID 58700125?
CID 58700125 has a molecular weight of 628.60 g/mol, XLogP of 7.19, 21 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58700125 is sourced from PubChem (CID 58700125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).