C15H20N2O3S — CID 58700204
1-diazo-1-(5-ethyl-2-methylphenyl)sulfonyl-3,3-dimethylbutan-2-one (PubChem CID 58700204) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-diazo-1-(5-ethyl-2-methylphenyl)sulfonyl-3,3-dimethylbutan-2-one.
| Compound Name | 1-diazo-1-(5-ethyl-2-methylphenyl)sulfonyl-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 58700204 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-diazo-1-(5-ethyl-2-methylphenyl)sulfonyl-3,3-dimethylbutan-2-one |
| SMILES | CCc1ccc(C)c(S(=O)(=O)C(=[N+]=[N-])C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H20N2O3S/c1-6-11-8-7-10(2)12(9-11)21(19,20)14(17-16)13(18)15(3,4)5/h7-9H,6H2,1-5H3 |
| InChIKey | QEIRQNPHDIBEMR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|