C20H21FN4 — CID 58700361
(4aS,9bR)-8-(4-fluoro-2-methylanilino)-5-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole-6-carbonitrile (PubChem CID 58700361) has the molecular formula C20H21FN4 and a molecular weight of 336.41 g/mol. Its IUPAC name is (4aS,9bR)-8-(4-fluoro-2-methylanilino)-5-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole-6-carbonitrile.
| Compound Name | (4aS,9bR)-8-(4-fluoro-2-methylanilino)-5-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole-6-carbonitrile |
|---|---|
| PubChem CID | 58700361 |
| Molecular Formula | C20H21FN4 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (4aS,9bR)-8-(4-fluoro-2-methylanilino)-5-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole-6-carbonitrile |
| SMILES | Cc1cc(F)ccc1Nc1cc(C#N)c2c(c1)[C@@H]1CNCC[C@@H]1N2C |
| InChI | InChI=1S/C20H21FN4/c1-12-7-14(21)3-4-18(12)24-15-8-13(10-22)20-16(9-15)17-11-23-6-5-19(17)25(20)2/h3-4,7-9,17,19,23-24H,5-6,11H2,1-2H3/t17-,19-/m0/s1 |
| InChIKey | STMVUVQWRXSODC-HKUYNNGSSA-N |
| XLogP | 3.64 |
| TPSA | 51.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |